C37H45N5O5S — CID 6682986
6-acetamido-N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 6682986) has the molecular formula C37H45N5O5S and a molecular weight of 671.86 g/mol. Its IUPAC name is 6-acetamido-N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6682986 |
| Molecular Formula | C37H45N5O5S |
| Molecular Weight | 671.86 g/mol |
| Exact Mass | 671.31 |
| IUPAC Name | 6-acetamido-N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](CSc3nncn3C)[C@H](C)[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C37H45N5O5S/c1-25-33(23-48-37-41-40-24-42(37)3)46-36(47-35(25)29-14-12-27(22-43)13-15-29)30-18-16-28(17-19-30)32-10-7-6-9-31(32)21-39-34(45)11-5-4-8-20-38-26(2)44/h6-7,9-10,12-19,24-25,33,35-36,43H,4-5,8,11,20-23H2,1-3H3,(H,38,44)(H,39,45)/t25-,33+,35+,36+/m0/s1 |
| InChIKey | LSFATJLQLPBBBA-CGBWUOKJSA-N |
| XLogP | 5.87 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.86 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|