C36H43N5O5S — CID 6694414
6-acetamido-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 6694414) has the molecular formula C36H43N5O5S and a molecular weight of 657.84 g/mol. Its IUPAC name is 6-acetamido-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6694414 |
| Molecular Formula | C36H43N5O5S |
| Molecular Weight | 657.84 g/mol |
| Exact Mass | 657.30 |
| IUPAC Name | 6-acetamido-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccccc1-c1ccc([C@@H]2O[C@H](CSc3nncn3C)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C36H43N5O5S/c1-25(43)37-19-7-3-4-10-34(44)38-21-30-8-5-6-9-32(30)27-15-17-29(18-16-27)35-45-31(23-47-36-40-39-24-41(36)2)20-33(46-35)28-13-11-26(22-42)12-14-28/h5-6,8-9,11-18,24,31,33,35,42H,3-4,7,10,19-23H2,1-2H3,(H,37,43)(H,38,44)/t31-,33+,35+/m0/s1 |
| InChIKey | VAWUMUCKZMECPW-LWKLBADKSA-N |
| XLogP | 5.62 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.84 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|