C28H34N4O6S — CID 6673145
6-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-6-oxohexanoic acid (PubChem CID 6673145) has the molecular formula C28H34N4O6S and a molecular weight of 554.67 g/mol. Its IUPAC name is 6-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6673145 |
| Molecular Formula | C28H34N4O6S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 6-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methylamino]-6-oxohexanoic acid |
| SMILES | Cn1cnnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)CCCCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C28H34N4O6S/c1-32-18-30-31-28(32)39-17-23-14-24(21-10-8-20(16-33)9-11-21)38-27(37-23)22-12-6-19(7-13-22)15-29-25(34)4-2-3-5-26(35)36/h6-13,18,23-24,27,33H,2-5,14-17H2,1H3,(H,29,34)(H,35,36)/t23-,24+,27+/m1/s1 |
| InChIKey | JXGIQKWABIETNI-DXBVXKBHSA-N |
| XLogP | 3.91 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|