C33H38N6O5S — CID 6676744
N'-(2-aminophenyl)-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide (PubChem CID 6676744) has the molecular formula C33H38N6O5S and a molecular weight of 630.77 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 6676744 |
| Molecular Formula | C33H38N6O5S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide |
| SMILES | Cn1cnnc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)CCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C33H38N6O5S/c1-39-21-36-38-33(39)45-20-26-17-29(24-13-11-23(19-40)12-14-24)44-32(43-26)25-15-9-22(10-16-25)18-35-30(41)7-4-8-31(42)37-28-6-3-2-5-27(28)34/h2-3,5-6,9-16,21,26,29,32,40H,4,7-8,17-20,34H2,1H3,(H,35,41)(H,37,42)/t26-,29+,32+/m0/s1 |
| InChIKey | MBJOFJDGNHVWLA-MRPJDYLLSA-N |
| XLogP | 4.65 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|