C34H40N6O5S — CID 3455996
N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 3455996) has the molecular formula C34H40N6O5S and a molecular weight of 644.80 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 3455996 |
| Molecular Formula | C34H40N6O5S |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | Cn1cnnc1SCC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCCC(=O)Nc3ccccc3N)c2)O1 |
| InChI | InChI=1S/C34H40N6O5S/c1-40-22-36-39-34(40)46-21-27-19-30(24-16-14-23(20-41)15-17-24)45-33(44-27)25-8-7-9-26(18-25)37-31(42)12-3-2-4-13-32(43)38-29-11-6-5-10-28(29)35/h5-11,14-18,22,27,30,33,41H,2-4,12-13,19-21,35H2,1H3,(H,37,42)(H,38,43) |
| InChIKey | HWXBYMDIFIMEOE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|