C37H39N7O5S — CID 6674923
N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6674923) has the molecular formula C37H39N7O5S and a molecular weight of 693.83 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6674923 |
| Molecular Formula | C37H39N7O5S |
| Molecular Weight | 693.83 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1cccc([C@H]2O[C@@H](CSc3nnnn3-c3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C37H39N7O5S/c38-31-13-4-5-14-32(31)40-35(47)16-7-6-15-34(46)39-28-10-8-9-27(21-28)36-48-30(22-33(49-36)26-19-17-25(23-45)18-20-26)24-50-37-41-42-43-44(37)29-11-2-1-3-12-29/h1-5,8-14,17-21,30,33,36,45H,6-7,15-16,22-24,38H2,(H,39,46)(H,40,47)/t30-,33+,36+/m1/s1 |
| InChIKey | KEKMSRDHJJZFLU-MEGKMBSGSA-N |
| XLogP | 6.21 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.83 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|