C40H45N7O5S — CID 3278293
N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide (PubChem CID 3278293) has the molecular formula C40H45N7O5S and a molecular weight of 735.91 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 3278293 |
| Molecular Formula | C40H45N7O5S |
| Molecular Weight | 735.91 g/mol |
| Exact Mass | 735.32 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCCC(=O)NCc1ccc(C2OC(CSc3nnnn3-c3ccccc3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C40H45N7O5S/c41-34-12-8-9-13-35(34)43-38(50)15-7-2-1-6-14-37(49)42-25-28-16-22-31(23-17-28)39-51-33(24-36(52-39)30-20-18-29(26-48)19-21-30)27-53-40-44-45-46-47(40)32-10-4-3-5-11-32/h3-5,8-13,16-23,33,36,39,48H,1-2,6-7,14-15,24-27,41H2,(H,42,49)(H,43,50) |
| InChIKey | PPCAGGQJLMRDOC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.91 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|