C33H37N5O6S — CID 6678539
8-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid (PubChem CID 6678539) has the molecular formula C33H37N5O6S and a molecular weight of 631.76 g/mol. Its IUPAC name is 8-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid.
| Compound Name | 8-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6678539 |
| Molecular Formula | C33H37N5O6S |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | 8-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)Nc1ccc([C@@H]2O[C@H](CSc3nnnn3-c3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C33H37N5O6S/c39-21-23-12-14-24(15-13-23)29-20-28(22-45-33-35-36-37-38(33)27-8-4-3-5-9-27)43-32(44-29)25-16-18-26(19-17-25)34-30(40)10-6-1-2-7-11-31(41)42/h3-5,8-9,12-19,28-29,32,39H,1-2,6-7,10-11,20-22H2,(H,34,40)(H,41,42)/t28-,29+,32+/m0/s1 |
| InChIKey | MIJQOXHNCHGYGT-NPLMNSEMSA-N |
| XLogP | 5.86 |
| TPSA | 148.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|