C38H41N7O5S — CID 6674938
N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 6674938) has the molecular formula C38H41N7O5S and a molecular weight of 707.86 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 6674938 |
| Molecular Formula | C38H41N7O5S |
| Molecular Weight | 707.86 g/mol |
| Exact Mass | 707.29 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(=O)Nc1ccc([C@H]2O[C@@H](CSc3nnnn3-c3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C38H41N7O5S/c39-32-11-7-8-12-33(32)41-36(48)14-6-2-5-13-35(47)40-29-21-19-28(20-22-29)37-49-31(23-34(50-37)27-17-15-26(24-46)16-18-27)25-51-38-42-43-44-45(38)30-9-3-1-4-10-30/h1,3-4,7-12,15-22,31,34,37,46H,2,5-6,13-14,23-25,39H2,(H,40,47)(H,41,48)/t31-,34+,37+/m1/s1 |
| InChIKey | BHVJFQJCCVJVGM-UJOJRLIHSA-N |
| XLogP | 6.60 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.86 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|