C32H36N6O5S — CID 6676732
N'-(2-aminophenyl)-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pentanediamide (PubChem CID 6676732) has the molecular formula C32H36N6O5S and a molecular weight of 616.74 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 6676732 |
| Molecular Formula | C32H36N6O5S |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]pentanediamide |
| SMILES | Cn1cnnc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)CCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C32H36N6O5S/c1-38-20-34-37-32(38)44-19-25-17-28(22-11-9-21(18-39)10-12-22)43-31(42-25)23-13-15-24(16-14-23)35-29(40)7-4-8-30(41)36-27-6-3-2-5-26(27)33/h2-3,5-6,9-16,20,25,28,31,39H,4,7-8,17-19,33H2,1H3,(H,35,40)(H,36,41)/t25-,28+,31+/m0/s1 |
| InChIKey | MSYZNNCBZZNTDK-BOBPPRSMSA-N |
| XLogP | 4.97 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|