C23H23Cl3N4O4S — CID 4178391
2,2,2-trichloro-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 4178391) has the molecular formula C23H23Cl3N4O4S and a molecular weight of 557.89 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 4178391 |
| Molecular Formula | C23H23Cl3N4O4S |
| Molecular Weight | 557.89 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | Cn1cnnc1SCC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)O1 |
| InChI | InChI=1S/C23H23Cl3N4O4S/c1-30-13-27-29-22(30)35-12-18-10-19(15-4-2-14(11-31)3-5-15)34-20(33-18)16-6-8-17(9-7-16)28-21(32)23(24,25)26/h2-9,13,18-20,31H,10-12H2,1H3,(H,28,32) |
| InChIKey | YSNPVCNVUVWXQT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|