C34H33N5O5S — CID 6706476
1-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6706476) has the molecular formula C34H33N5O5S and a molecular weight of 623.74 g/mol. Its IUPAC name is 1-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6706476 |
| Molecular Formula | C34H33N5O5S |
| Molecular Weight | 623.74 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | 1-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
| SMILES | Cn1cnnc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)Nc3ccc(Oc4ccccc4)cc3)cc2)O1 |
| InChI | InChI=1S/C34H33N5O5S/c1-39-22-35-38-34(39)45-21-30-19-31(24-9-7-23(20-40)8-10-24)44-32(43-30)25-11-13-26(14-12-25)36-33(41)37-27-15-17-29(18-16-27)42-28-5-3-2-4-6-28/h2-18,22,30-32,40H,19-21H2,1H3,(H2,36,37,41)/t30-,31+,32+/m0/s1 |
| InChIKey | VRGPACSJIBMUTG-DCMFLLSESA-N |
| XLogP | 7.08 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.74 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |