C29H31N5O4S — CID 6694354
1-benzyl-3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6694354) has the molecular formula C29H31N5O4S and a molecular weight of 545.67 g/mol. Its IUPAC name is 1-benzyl-3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-benzyl-3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6694354 |
| Molecular Formula | C29H31N5O4S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 1-benzyl-3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | Cn1cnnc1SC[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)NCc3ccccc3)c2)O1 |
| InChI | InChI=1S/C29H31N5O4S/c1-34-19-31-33-29(34)39-18-25-15-26(22-12-10-21(17-35)11-13-22)38-27(37-25)23-8-5-9-24(14-23)32-28(36)30-16-20-6-3-2-4-7-20/h2-14,19,25-27,35H,15-18H2,1H3,(H2,30,32,36)/t25-,26+,27+/m0/s1 |
| InChIKey | MAYNVQHEYLMVKU-OYUWMTPXSA-N |
| XLogP | 4.97 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |