C36H37N5O4S — CID 6699914
1-benzyl-3-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6699914) has the molecular formula C36H37N5O4S and a molecular weight of 635.79 g/mol. Its IUPAC name is 1-benzyl-3-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6699914 |
| Molecular Formula | C36H37N5O4S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | 1-benzyl-3-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | Cn1cnnc1SC[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)NCc3ccccc3)cc2)O1 |
| InChI | InChI=1S/C36H37N5O4S/c1-41-24-39-40-36(41)46-23-31-19-33(28-13-11-26(22-42)12-14-28)45-34(44-31)29-17-15-27(16-18-29)32-10-6-5-9-30(32)21-38-35(43)37-20-25-7-3-2-4-8-25/h2-18,24,31,33-34,42H,19-23H2,1H3,(H2,37,38,43)/t31-,33+,34+/m1/s1 |
| InChIKey | FQBHGGRLMDBITA-BJJUCXOISA-N |
| XLogP | 6.31 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |