C24H25Cl3N4O4S — CID 5064781
2,2,2-trichloro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 5064781) has the molecular formula C24H25Cl3N4O4S and a molecular weight of 571.91 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 5064781 |
| Molecular Formula | C24H25Cl3N4O4S |
| Molecular Weight | 571.91 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | Cn1cnnc1SCC1CC(c2ccc(CO)cc2)OC(c2ccc(CNC(=O)C(Cl)(Cl)Cl)cc2)O1 |
| InChI | InChI=1S/C24H25Cl3N4O4S/c1-31-14-29-30-23(31)36-13-19-10-20(17-6-4-16(12-32)5-7-17)35-21(34-19)18-8-2-15(3-9-18)11-28-22(33)24(25,26)27/h2-9,14,19-21,32H,10-13H2,1H3,(H,28,33) |
| InChIKey | NRAJHNZAQIFOBN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.91 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|