C28H26Cl3NO6S — CID 6701610
4-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[4-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6701610) has the molecular formula C28H26Cl3NO6S and a molecular weight of 610.94 g/mol. Its IUPAC name is 4-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[4-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[4-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6701610 |
| Molecular Formula | C28H26Cl3NO6S |
| Molecular Weight | 610.94 g/mol |
| Exact Mass | 609.05 |
| IUPAC Name | 4-[[(2R,4R,6S)-6-[4-(hydroxymethyl)phenyl]-2-[4-[[(2,2,2-trichloroacetyl)amino]methyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccc(SC[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(CNC(=O)C(Cl)(Cl)Cl)cc3)O2)cc1 |
| InChI | InChI=1S/C28H26Cl3NO6S/c29-28(30,31)27(36)32-14-17-1-7-21(8-2-17)26-37-22(16-39-23-11-9-20(10-12-23)25(34)35)13-24(38-26)19-5-3-18(15-33)4-6-19/h1-12,22,24,26,33H,13-16H2,(H,32,36)(H,34,35)/t22-,24+,26+/m1/s1 |
| InChIKey | QHJACRHFMGNISB-CWDLOFLHSA-N |
| XLogP | 6.20 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.94 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|