C28H35Cl3N2O4 — CID 6694137
N-[[4-[(2S,4S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-2,2,2-trichloroacetamide (PubChem CID 6694137) has the molecular formula C28H35Cl3N2O4 and a molecular weight of 569.96 g/mol. Its IUPAC name is N-[[4-[(2S,4S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[[4-[(2S,4S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 6694137 |
| Molecular Formula | C28H35Cl3N2O4 |
| Molecular Weight | 569.96 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | N-[[4-[(2S,4S,6R)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-2,2,2-trichloroacetamide |
| SMILES | O=C(NCc1ccc([C@@H]2O[C@H](CN3CCCCCCC3)C[C@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H35Cl3N2O4/c29-28(30,31)27(35)32-17-20-6-12-23(13-7-20)26-36-24(18-33-14-4-2-1-3-5-15-33)16-25(37-26)22-10-8-21(19-34)9-11-22/h6-13,24-26,34H,1-5,14-19H2,(H,32,35)/t24-,25+,26+/m0/s1 |
| InChIKey | LSWMMWVFNNNKCR-JIMJEQGWSA-N |
| XLogP | 5.98 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.96 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|