C30H40N2O5 — CID 3306304
prop-2-enyl N-[[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate (PubChem CID 3306304) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is prop-2-enyl N-[[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 3306304 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | prop-2-enyl N-[[4-[4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1ccc(C2OC(CN3CCCCCCC3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C30H40N2O5/c1-2-18-35-30(34)31-20-23-8-14-26(15-9-23)29-36-27(21-32-16-6-4-3-5-7-17-32)19-28(37-29)25-12-10-24(22-33)11-13-25/h2,8-15,27-29,33H,1,3-7,16-22H2,(H,31,34) |
| InChIKey | FATCOSWIHWTZOV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|