C36H42N4O6 — CID 6698093
prop-2-enyl N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate (PubChem CID 6698093) has the molecular formula C36H42N4O6 and a molecular weight of 626.75 g/mol. Its IUPAC name is prop-2-enyl N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6698093 |
| Molecular Formula | C36H42N4O6 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | prop-2-enyl N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1ccc([C@@H]2O[C@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C36H42N4O6/c1-2-20-44-35(43)37-22-26-8-14-29(15-9-26)33-45-31(21-32(46-33)28-12-10-27(24-41)11-13-28)23-39-18-16-36(17-19-39)34(42)38-25-40(36)30-6-4-3-5-7-30/h2-15,31-33,41H,1,16-25H2,(H,37,43)(H,38,42)/t31-,32+,33+/m0/s1 |
| InChIKey | ISSFMJCRASPASK-WIHCDAFUSA-N |
| XLogP | 4.57 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|