C46H49N5O5 — CID 6703631
1-benzyl-3-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6703631) has the molecular formula C46H49N5O5 and a molecular weight of 751.93 g/mol. Its IUPAC name is 1-benzyl-3-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6703631 |
| Molecular Formula | C46H49N5O5 |
| Molecular Weight | 751.93 g/mol |
| Exact Mass | 751.37 |
| IUPAC Name | 1-benzyl-3-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1)NCc1cccc(-c2ccc([C@H]3O[C@@H](CN4CCC5(CC4)C(=O)NCN5c4ccccc4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C46H49N5O5/c52-31-34-14-16-37(17-15-34)42-27-41(30-50-24-22-46(23-25-50)44(53)49-32-51(46)40-12-5-2-6-13-40)55-43(56-42)38-20-18-36(19-21-38)39-11-7-10-35(26-39)29-48-45(54)47-28-33-8-3-1-4-9-33/h1-21,26,41-43,52H,22-25,27-32H2,(H,49,53)(H2,47,48,54)/t41-,42+,43+/m1/s1 |
| InChIKey | RVYTYUKQJFSCCY-PYHIYFCPSA-N |
| XLogP | 6.82 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.93 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |