C34H40N4O5 — CID 6698103
N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6698103) has the molecular formula C34H40N4O5 and a molecular weight of 584.72 g/mol. Its IUPAC name is N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6698103 |
| Molecular Formula | C34H40N4O5 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc([C@@H]2O[C@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C34H40N4O5/c1-24(40)35-20-25-7-13-28(14-8-25)32-42-30(19-31(43-32)27-11-9-26(22-39)10-12-27)21-37-17-15-34(16-18-37)33(41)36-23-38(34)29-5-3-2-4-6-29/h2-14,30-32,39H,15-23H2,1H3,(H,35,40)(H,36,41)/t30-,31+,32+/m0/s1 |
| InChIKey | HPWQQCJQTYAWNX-DCMFLLSESA-N |
| XLogP | 3.79 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |