C39H48N4O7 — CID 6679187
8-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid (PubChem CID 6679187) has the molecular formula C39H48N4O7 and a molecular weight of 684.83 g/mol. Its IUPAC name is 8-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid.
| Compound Name | 8-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6679187 |
| Molecular Formula | C39H48N4O7 |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | 8-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]anilino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)Nc1ccc([C@@H]2O[C@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C39H48N4O7/c44-26-28-12-14-29(15-13-28)34-24-33(25-42-22-20-39(21-23-42)38(48)40-27-43(39)32-8-4-3-5-9-32)49-37(50-34)30-16-18-31(19-17-30)41-35(45)10-6-1-2-7-11-36(46)47/h3-5,8-9,12-19,33-34,37,44H,1-2,6-7,10-11,20-27H2,(H,40,48)(H,41,45)(H,46,47)/t33-,34+,37+/m0/s1 |
| InChIKey | RXICMECAMISFBL-YTFBDJPQSA-N |
| XLogP | 5.52 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|