C44H50N4O7 — CID 6675617
6-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid (PubChem CID 6675617) has the molecular formula C44H50N4O7 and a molecular weight of 746.90 g/mol. Its IUPAC name is 6-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6675617 |
| Molecular Formula | C44H50N4O7 |
| Molecular Weight | 746.90 g/mol |
| Exact Mass | 746.37 |
| IUPAC Name | 6-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C44H50N4O7/c49-29-31-14-16-33(17-15-31)39-26-37(28-47-24-22-44(23-25-47)43(53)46-30-48(44)36-9-2-1-3-10-36)54-42(55-39)34-20-18-32(19-21-34)38-11-5-4-8-35(38)27-45-40(50)12-6-7-13-41(51)52/h1-5,8-11,14-21,37,39,42,49H,6-7,12-13,22-30H2,(H,45,50)(H,46,53)(H,51,52)/t37-,39+,42+/m1/s1 |
| InChIKey | AAWXVFBRNHOZCJ-QJDYDKQLSA-N |
| XLogP | 6.08 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|