C40H41Cl3N4O5 — CID 6698138
2,2,2-trichloro-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6698138) has the molecular formula C40H41Cl3N4O5 and a molecular weight of 764.15 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6698138 |
| Molecular Formula | C40H41Cl3N4O5 |
| Molecular Weight | 764.15 g/mol |
| Exact Mass | 762.21 |
| IUPAC Name | 2,2,2-trichloro-N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccccc1-c1ccc([C@@H]2O[C@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C40H41Cl3N4O5/c41-40(42,43)38(50)44-23-31-6-4-5-9-34(31)28-14-16-30(17-15-28)36-51-33(22-35(52-36)29-12-10-27(25-48)11-13-29)24-46-20-18-39(19-21-46)37(49)45-26-47(39)32-7-2-1-3-8-32/h1-17,33,35-36,48H,18-26H2,(H,44,50)(H,45,49)/t33-,35+,36+/m0/s1 |
| InChIKey | HUQSVUUSOOUTKE-DFOKCWARSA-N |
| XLogP | 6.81 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.15 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|