C44H46N4O6S — CID 6698141
N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide (PubChem CID 6698141) has the molecular formula C44H46N4O6S and a molecular weight of 758.94 g/mol. Its IUPAC name is N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6698141 |
| Molecular Formula | C44H46N4O6S |
| Molecular Weight | 758.94 g/mol |
| Exact Mass | 758.31 |
| IUPAC Name | N-[[2-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(C[C@@H]1C[C@H](c3ccc(CO)cc3)O[C@H](c3ccc(-c4ccccc4CNS(=O)(=O)c4ccccc4)cc3)O1)CC2 |
| InChI | InChI=1S/C44H46N4O6S/c49-30-32-15-17-34(18-16-32)41-27-38(29-47-25-23-44(24-26-47)43(50)45-31-48(44)37-10-3-1-4-11-37)53-42(54-41)35-21-19-33(20-22-35)40-14-8-7-9-36(40)28-46-55(51,52)39-12-5-2-6-13-39/h1-22,38,41-42,46,49H,23-31H2,(H,45,50)/t38-,41+,42+/m0/s1 |
| InChIKey | JURQXVPCHCJIGC-FKAXQMLKSA-N |
| XLogP | 6.30 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.94 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |