C31H36N4O4 — CID 6698070
8-[[(2S,4S,6R)-2-(3-aminophenyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 6698070) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 8-[[(2S,4S,6R)-2-(3-aminophenyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[[(2S,4S,6R)-2-(3-aminophenyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 6698070 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 8-[[(2S,4S,6R)-2-(3-aminophenyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | Nc1cccc([C@@H]2O[C@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C31H36N4O4/c32-25-6-4-5-24(17-25)29-38-27(18-28(39-29)23-11-9-22(20-36)10-12-23)19-34-15-13-31(14-16-34)30(37)33-21-35(31)26-7-2-1-3-8-26/h1-12,17,27-29,36H,13-16,18-21,32H2,(H,33,37)/t27-,28+,29+/m0/s1 |
| InChIKey | JWWZQLVEWYXWDV-ZGIBFIJWSA-N |
| XLogP | 3.73 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|