C44H45N5O6 — CID 6703585
1-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6703585) has the molecular formula C44H45N5O6 and a molecular weight of 739.87 g/mol. Its IUPAC name is 1-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6703585 |
| Molecular Formula | C44H45N5O6 |
| Molecular Weight | 739.87 g/mol |
| Exact Mass | 739.34 |
| IUPAC Name | 1-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)Nc1cccc([C@H]2O[C@@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C44H45N5O6/c50-29-31-14-16-32(17-15-31)40-27-39(28-48-24-22-44(23-25-48)42(51)45-30-49(44)36-10-3-1-4-11-36)54-41(55-40)33-8-7-9-35(26-33)47-43(52)46-34-18-20-38(21-19-34)53-37-12-5-2-6-13-37/h1-21,26,39-41,50H,22-25,27-30H2,(H,45,51)(H2,46,47,52)/t39-,40+,41+/m1/s1 |
| InChIKey | WCMWAMPIOHPNFP-AEKUSUEZSA-N |
| XLogP | 7.59 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.87 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |