C42H51N5O5 — CID 6707191
1-(1-adamantyl)-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6707191) has the molecular formula C42H51N5O5 and a molecular weight of 705.90 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6707191 |
| Molecular Formula | C42H51N5O5 |
| Molecular Weight | 705.90 g/mol |
| Exact Mass | 705.39 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc([C@@H]2O[C@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C42H51N5O5/c48-26-28-6-8-32(9-7-28)37-21-36(25-46-16-14-42(15-17-46)39(49)43-27-47(42)35-4-2-1-3-5-35)51-38(52-37)33-10-12-34(13-11-33)44-40(50)45-41-22-29-18-30(23-41)20-31(19-29)24-41/h1-13,29-31,36-38,48H,14-27H2,(H,43,49)(H2,44,45,50)/t29?,30?,31?,36-,37+,38+,41?/m0/s1 |
| InChIKey | FNQMYGGPCVFHNQ-FGQJSXMWSA-N |
| XLogP | 6.24 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.90 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |