C40H40N6O5 — CID 6708229
N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide (PubChem CID 6708229) has the molecular formula C40H40N6O5 and a molecular weight of 684.80 g/mol. Its IUPAC name is N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6708229 |
| Molecular Formula | C40H40N6O5 |
| Molecular Weight | 684.80 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | N-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
| SMILES | O=C(Nc1ccc([C@H]2O[C@@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)C[C@@H](c3ccc(CO)cc3)O2)cc1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C40H40N6O5/c47-25-27-10-12-28(13-11-27)36-22-32(24-45-20-18-40(19-21-45)39(49)42-26-46(40)31-6-2-1-3-7-31)50-38(51-36)29-14-16-30(17-15-29)43-37(48)35-23-41-33-8-4-5-9-34(33)44-35/h1-17,23,32,36,38,47H,18-22,24-26H2,(H,42,49)(H,43,48)/t32-,36+,38+/m1/s1 |
| InChIKey | YGVUSIXSWWLIHL-AQMGKWKNSA-N |
| XLogP | 5.35 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |