C34H36N4O6 — CID 6701155
N-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide (PubChem CID 6701155) has the molecular formula C34H36N4O6 and a molecular weight of 596.68 g/mol. Its IUPAC name is N-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6701155 |
| Molecular Formula | C34H36N4O6 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | N-[3-[(2R,4R,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
| SMILES | O=C(Nc1cccc([C@H]2O[C@@H](CN3CCC4(CC3)OCCO4)C[C@@H](c3ccc(CO)cc3)O2)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C34H36N4O6/c39-22-23-8-10-24(11-9-23)31-19-27(21-38-14-12-34(13-15-38)41-16-17-42-34)43-33(44-31)25-4-3-5-26(18-25)36-32(40)30-20-35-28-6-1-2-7-29(28)37-30/h1-11,18,20,27,31,33,39H,12-17,19,21-22H2,(H,36,40)/t27-,31+,33+/m1/s1 |
| InChIKey | DNXBYFYWMKDXEN-MSIZFFOJSA-N |
| XLogP | 4.76 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |