C41H42N4O6 — CID 6695749
N-[[3-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 6695749) has the molecular formula C41H42N4O6 and a molecular weight of 686.81 g/mol. Its IUPAC name is N-[[3-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[3-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6695749 |
| Molecular Formula | C41H42N4O6 |
| Molecular Weight | 686.81 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | N-[[3-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | O=C(NCc1cccc(-c2cccc([C@@H]3O[C@H](CN4CCC5(CC4)OCCO5)C[C@H](c4ccc(CO)cc4)O3)c2)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C41H42N4O6/c46-27-28-11-13-30(14-12-28)38-23-34(26-45-17-15-41(16-18-45)48-19-20-49-41)50-40(51-38)33-8-4-7-32(22-33)31-6-3-5-29(21-31)24-43-39(47)37-25-42-35-9-1-2-10-36(35)44-37/h1-14,21-22,25,34,38,40,46H,15-20,23-24,26-27H2,(H,43,47)/t34-,38+,40+/m0/s1 |
| InChIKey | IBJKNIONLUKWPD-YGRKWHPQSA-N |
| XLogP | 6.10 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.81 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |