C38H41N3O6 — CID 6695748
N-[[3-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 6695748) has the molecular formula C38H41N3O6 and a molecular weight of 635.76 g/mol. Its IUPAC name is N-[[3-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[3-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6695748 |
| Molecular Formula | C38H41N3O6 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | N-[[3-[3-[(2S,4S,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccc(-c2cccc([C@@H]3O[C@H](CN4CCC5(CC4)OCCO5)C[C@H](c4ccc(CO)cc4)O3)c2)c1)c1cccnc1 |
| InChI | InChI=1S/C38H41N3O6/c42-26-27-9-11-29(12-10-27)35-22-34(25-41-16-13-38(14-17-41)44-18-19-45-38)46-37(47-35)32-7-2-6-31(21-32)30-5-1-4-28(20-30)23-40-36(43)33-8-3-15-39-24-33/h1-12,15,20-21,24,34-35,37,42H,13-14,16-19,22-23,25-26H2,(H,40,43)/t34-,35+,37+/m0/s1 |
| InChIKey | MWVSIGNRKAWPTG-UQDPWRLZSA-N |
| XLogP | 5.56 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |