C41H41N5O6 — CID 4063090
N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 4063090) has the molecular formula C41H41N5O6 and a molecular weight of 699.81 g/mol. Its IUPAC name is N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4063090 |
| Molecular Formula | C41H41N5O6 |
| Molecular Weight | 699.81 g/mol |
| Exact Mass | 699.31 |
| IUPAC Name | N-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccc(-c2ccc(C3OC(CN4CCN(c5ccc([N+](=O)[O-])cc5)CC4)CC(c4ccc(CO)cc4)O3)cc2)c1)c1cccnc1 |
| InChI | InChI=1S/C41H41N5O6/c47-28-29-6-8-32(9-7-29)39-24-38(27-44-19-21-45(22-20-44)36-14-16-37(17-15-36)46(49)50)51-41(52-39)33-12-10-31(11-13-33)34-4-1-3-30(23-34)25-43-40(48)35-5-2-18-42-26-35/h1-18,23,26,38-39,41,47H,19-22,24-25,27-28H2,(H,43,48) |
| InChIKey | NDKVBWBNHSEHSP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.81 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|