C40H44N4O8 — CID 3354072
5-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 3354072) has the molecular formula C40H44N4O8 and a molecular weight of 708.81 g/mol. Its IUPAC name is 5-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 3354072 |
| Molecular Formula | C40H44N4O8 |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | 5-[[3-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCc1cccc(-c2cccc(C3OC(CN4CCN(c5ccc([N+](=O)[O-])cc5)CC4)CC(c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C40H44N4O8/c45-27-28-10-12-30(13-11-28)37-24-36(26-42-18-20-43(21-19-42)34-14-16-35(17-15-34)44(49)50)51-40(52-37)33-7-2-6-32(23-33)31-5-1-4-29(22-31)25-41-38(46)8-3-9-39(47)48/h1-2,4-7,10-17,22-23,36-37,40,45H,3,8-9,18-21,24-27H2,(H,41,46)(H,47,48) |
| InChIKey | ZFVAJOBTGQDTGL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 154.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|