C43H50N4O8 — CID 6675407
8-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6675407) has the molecular formula C43H50N4O8 and a molecular weight of 750.89 g/mol. Its IUPAC name is 8-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6675407 |
| Molecular Formula | C43H50N4O8 |
| Molecular Weight | 750.89 g/mol |
| Exact Mass | 750.36 |
| IUPAC Name | 8-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C43H50N4O8/c48-30-31-11-13-33(14-12-31)40-27-38(29-45-23-25-46(26-24-45)36-19-21-37(22-20-36)47(52)53)54-43(55-40)34-17-15-32(16-18-34)39-8-6-5-7-35(39)28-44-41(49)9-3-1-2-4-10-42(50)51/h5-8,11-22,38,40,43,48H,1-4,9-10,23-30H2,(H,44,49)(H,50,51)/t38-,40+,43+/m1/s1 |
| InChIKey | OKQUQQMOMIWXLA-ZPRHKEMQSA-N |
| XLogP | 7.16 |
| TPSA | 154.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.89 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|