C37H46N4O8 — CID 6678983
8-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid (PubChem CID 6678983) has the molecular formula C37H46N4O8 and a molecular weight of 674.79 g/mol. Its IUPAC name is 8-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid.
| Compound Name | 8-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 6678983 |
| Molecular Formula | C37H46N4O8 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | 8-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)NCc1ccc([C@@H]2O[C@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C37H46N4O8/c42-26-28-9-11-29(12-10-28)34-23-33(25-39-19-21-40(22-20-39)31-15-17-32(18-16-31)41(46)47)48-37(49-34)30-13-7-27(8-14-30)24-38-35(43)5-3-1-2-4-6-36(44)45/h7-18,33-34,37,42H,1-6,19-26H2,(H,38,43)(H,44,45)/t33-,34+,37+/m0/s1 |
| InChIKey | OLLXCSVDGSTXGU-YTFBDJPQSA-N |
| XLogP | 5.50 |
| TPSA | 154.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|