C34H40N4O8 — CID 6675374
5-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6675374) has the molecular formula C34H40N4O8 and a molecular weight of 632.71 g/mol. Its IUPAC name is 5-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6675374 |
| Molecular Formula | C34H40N4O8 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 5-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCc1ccc([C@H]2O[C@@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C34H40N4O8/c39-23-25-6-8-26(9-7-25)31-20-30(22-36-16-18-37(19-17-36)28-12-14-29(15-13-28)38(43)44)45-34(46-31)27-10-4-24(5-11-27)21-35-32(40)2-1-3-33(41)42/h4-15,30-31,34,39H,1-3,16-23H2,(H,35,40)(H,41,42)/t30-,31+,34+/m1/s1 |
| InChIKey | XCNRHCXZJCYEPQ-JGBIIJINSA-N |
| XLogP | 4.33 |
| TPSA | 154.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|