C33H38N4O8 — CID 4199143
5-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid (PubChem CID 4199143) has the molecular formula C33H38N4O8 and a molecular weight of 618.69 g/mol. Its IUPAC name is 5-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 4199143 |
| Molecular Formula | C33H38N4O8 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 5-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(C2OC(CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C33H38N4O8/c38-22-23-4-6-24(7-5-23)30-20-29(21-35-16-18-36(19-17-35)27-12-14-28(15-13-27)37(42)43)44-33(45-30)25-8-10-26(11-9-25)34-31(39)2-1-3-32(40)41/h4-15,29-30,33,38H,1-3,16-22H2,(H,34,39)(H,40,41) |
| InChIKey | VIDZLKZNFYWTHM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 154.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|