C35H36N4O6 — CID 6707111
N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6707111) has the molecular formula C35H36N4O6 and a molecular weight of 608.70 g/mol. Its IUPAC name is N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6707111 |
| Molecular Formula | C35H36N4O6 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc([C@@H]2O[C@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C[C@H](c3ccc(CO)cc3)O2)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H36N4O6/c40-24-25-6-8-26(9-7-25)33-22-32(23-37-18-20-38(21-19-37)30-14-16-31(17-15-30)39(42)43)44-35(45-33)28-10-12-29(13-11-28)36-34(41)27-4-2-1-3-5-27/h1-17,32-33,35,40H,18-24H2,(H,36,41)/t32-,33+,35+/m0/s1 |
| InChIKey | JEATWAZGOYQMGW-VUHKNJSWSA-N |
| XLogP | 5.71 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|