C43H45N5O6 — CID 4111558
1-benzyl-3-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 4111558) has the molecular formula C43H45N5O6 and a molecular weight of 727.86 g/mol. Its IUPAC name is 1-benzyl-3-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 4111558 |
| Molecular Formula | C43H45N5O6 |
| Molecular Weight | 727.86 g/mol |
| Exact Mass | 727.34 |
| IUPAC Name | 1-benzyl-3-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1)NCc1ccccc1-c1ccc(C2OC(CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)CC(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C43H45N5O6/c49-30-32-10-12-34(13-11-32)41-26-39(29-46-22-24-47(25-23-46)37-18-20-38(21-19-37)48(51)52)53-42(54-41)35-16-14-33(15-17-35)40-9-5-4-8-36(40)28-45-43(50)44-27-31-6-2-1-3-7-31/h1-21,39,41-42,49H,22-30H2,(H2,44,45,50) |
| InChIKey | HKBGXWSIEHSLJH-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.86 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|