C42H42N4O6 — CID 6703305
N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6703305) has the molecular formula C42H42N4O6 and a molecular weight of 698.82 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6703305 |
| Molecular Formula | C42H42N4O6 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.31 |
| IUPAC Name | N-[[2-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C[C@@H](c3ccc(CO)cc3)O2)cc1)c1ccccc1 |
| InChI | InChI=1S/C42H42N4O6/c47-29-30-10-12-32(13-11-30)40-26-38(28-44-22-24-45(25-23-44)36-18-20-37(21-19-36)46(49)50)51-42(52-40)34-16-14-31(15-17-34)39-9-5-4-8-35(39)27-43-41(48)33-6-2-1-3-7-33/h1-21,38,40,42,47H,22-29H2,(H,43,48)/t38-,40+,42+/m1/s1 |
| InChIKey | RQXIYPLOKMGXFG-ZPLFKMOLSA-N |
| XLogP | 7.05 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|