C36H39N5O6 — CID 6707129
1-benzyl-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6707129) has the molecular formula C36H39N5O6 and a molecular weight of 637.74 g/mol. Its IUPAC name is 1-benzyl-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-benzyl-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6707129 |
| Molecular Formula | C36H39N5O6 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | 1-benzyl-3-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1ccc([C@@H]2O[C@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C36H39N5O6/c42-25-27-6-8-28(9-7-27)34-22-33(24-39-18-20-40(21-19-39)31-14-16-32(17-15-31)41(44)45)46-35(47-34)29-10-12-30(13-11-29)38-36(43)37-23-26-4-2-1-3-5-26/h1-17,33-35,42H,18-25H2,(H2,37,38,43)/t33-,34+,35+/m0/s1 |
| InChIKey | AEFSLAPBOOWMJA-BMPTZRATSA-N |
| XLogP | 5.78 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|