C35H31F5N4O6 — CID 6703242
2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6703242) has the molecular formula C35H31F5N4O6 and a molecular weight of 698.65 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6703242 |
| Molecular Formula | C35H31F5N4O6 |
| Molecular Weight | 698.65 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc([C@H]2O[C@@H](CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)C[C@@H](c3ccc(CO)cc3)O2)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C35H31F5N4O6/c36-29-28(30(37)32(39)33(40)31(29)38)34(46)41-23-3-1-2-22(16-23)35-49-26(17-27(50-35)21-6-4-20(19-45)5-7-21)18-42-12-14-43(15-13-42)24-8-10-25(11-9-24)44(47)48/h1-11,16,26-27,35,45H,12-15,17-19H2,(H,41,46)/t26-,27+,35+/m1/s1 |
| InChIKey | ZAVDYJWSJLWHHH-RYOMNGFGSA-N |
| XLogP | 6.40 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|