C37H40N4O6 — CID 6697839
N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6697839) has the molecular formula C37H40N4O6 and a molecular weight of 636.75 g/mol. Its IUPAC name is N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6697839 |
| Molecular Formula | C37H40N4O6 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CN4CCN(c5ccc([N+](=O)[O-])cc5)CC4)C[C@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C37H40N4O6/c1-26(43)38-23-28-4-2-5-30(20-28)31-6-3-7-32(21-31)37-46-35(22-36(47-37)29-10-8-27(25-42)9-11-29)24-39-16-18-40(19-17-39)33-12-14-34(15-13-33)41(44)45/h2-15,20-21,35-37,42H,16-19,22-25H2,1H3,(H,38,43)/t35-,36+,37+/m0/s1 |
| InChIKey | YDJYGLHLLLMVHP-HKIDPNTFSA-N |
| XLogP | 5.76 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|