C40H45N5O8 — CID 6703297
ethyl 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6703297) has the molecular formula C40H45N5O8 and a molecular weight of 723.83 g/mol. Its IUPAC name is ethyl 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6703297 |
| Molecular Formula | C40H45N5O8 |
| Molecular Weight | 723.83 g/mol |
| Exact Mass | 723.33 |
| IUPAC Name | ethyl 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1cccc(-c2ccc([C@H]3O[C@@H](CN4CCN(c5ccc([N+](=O)[O-])cc5)CC4)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C40H45N5O8/c1-2-51-38(47)25-42-40(48)41-24-29-4-3-5-33(22-29)30-10-12-32(13-11-30)39-52-36(23-37(53-39)31-8-6-28(27-46)7-9-31)26-43-18-20-44(21-19-43)34-14-16-35(17-15-34)45(49)50/h3-17,22,36-37,39,46H,2,18-21,23-27H2,1H3,(H2,41,42,48)/t36-,37+,39+/m1/s1 |
| InChIKey | OLSNUKJHBXONMS-PJQHUZAUSA-N |
| XLogP | 5.48 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.83 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|