C40H46N6O7 — CID 3308943
N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 3308943) has the molecular formula C40H46N6O7 and a molecular weight of 722.84 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 3308943 |
| Molecular Formula | C40H46N6O7 |
| Molecular Weight | 722.84 g/mol |
| Exact Mass | 722.34 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1cccc(C2OC(CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)CC(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C40H46N6O7/c41-35-8-1-2-9-36(35)43-39(49)11-4-3-10-38(48)42-31-7-5-6-30(24-31)40-52-34(25-37(53-40)29-14-12-28(27-47)13-15-29)26-44-20-22-45(23-21-44)32-16-18-33(19-17-32)46(50)51/h1-2,5-9,12-19,24,34,37,40,47H,3-4,10-11,20-23,25-27,41H2,(H,42,48)(H,43,49) |
| InChIKey | UCKRJEMMLCFNLD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 172.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.84 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|