C42H48N6O6 — CID 6679099
N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6679099) has the molecular formula C42H48N6O6 and a molecular weight of 732.88 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6679099 |
| Molecular Formula | C42H48N6O6 |
| Molecular Weight | 732.88 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | Nc1ccccc1NC(=O)CCCCC(=O)Nc1cccc([C@@H]2O[C@H](CN3CCC(n4c(=O)[nH]c5ccccc54)CC3)C[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C42H48N6O6/c43-34-10-1-2-11-35(34)45-40(51)15-6-5-14-39(50)44-31-9-7-8-30(24-31)41-53-33(25-38(54-41)29-18-16-28(27-49)17-19-29)26-47-22-20-32(21-23-47)48-37-13-4-3-12-36(37)46-42(48)52/h1-4,7-13,16-19,24,32-33,38,41,49H,5-6,14-15,20-23,25-27,43H2,(H,44,50)(H,45,51)(H,46,52)/t33-,38+,41+/m0/s1 |
| InChIKey | BANLDHLZGVEPEK-MFDVBWRESA-N |
| XLogP | 6.42 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.88 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|