C37H45N5O7 — CID 4591325
N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide (PubChem CID 4591325) has the molecular formula C37H45N5O7 and a molecular weight of 671.79 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide.
| Compound Name | N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
|---|---|
| PubChem CID | 4591325 |
| Molecular Formula | C37H45N5O7 |
| Molecular Weight | 671.79 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)NCc1ccc(C2OC(CN3CCC(n4c(=O)[nH]c5ccccc54)CC3)CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C37H45N5O7/c43-24-26-11-13-27(14-12-26)33-21-30(23-41-19-17-29(18-20-41)42-32-6-2-1-5-31(32)39-37(42)46)48-36(49-33)28-15-9-25(10-16-28)22-38-34(44)7-3-4-8-35(45)40-47/h1-2,5-6,9-16,29-30,33,36,43,47H,3-4,7-8,17-24H2,(H,38,44)(H,39,46)(H,40,45) |
| InChIKey | DPJJHSPFKUMNJF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|