C31H43N3O7 — CID 5207825
N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(3-hydroxypyrrolidin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide (PubChem CID 5207825) has the molecular formula C31H43N3O7 and a molecular weight of 569.70 g/mol. Its IUPAC name is N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(3-hydroxypyrrolidin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide.
| Compound Name | N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(3-hydroxypyrrolidin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
|---|---|
| PubChem CID | 5207825 |
| Molecular Formula | C31H43N3O7 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | N'-hydroxy-N-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(3-hydroxypyrrolidin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)NCc1ccc(C2OC(CN3CCC(O)C3)CC(c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C31H43N3O7/c35-21-23-9-11-24(12-10-23)28-17-27(20-34-16-15-26(36)19-34)40-31(41-28)25-13-7-22(8-14-25)18-32-29(37)5-3-1-2-4-6-30(38)33-39/h7-14,26-28,31,35-36,39H,1-6,15-21H2,(H,32,37)(H,33,38) |
| InChIKey | AAJZETGWMIKXNO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|