C32H45N3O6 — CID 6673002
N-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyhexanediamide (PubChem CID 6673002) has the molecular formula C32H45N3O6 and a molecular weight of 567.73 g/mol. Its IUPAC name is N-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 6673002 |
| Molecular Formula | C32H45N3O6 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | N-[[4-[(2R,4R,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]-N'-hydroxyhexanediamide |
| SMILES | O=C(CCCCC(=O)NCc1ccc([C@H]2O[C@@H](CN3CCCCCCC3)C[C@@H](c3ccc(CO)cc3)O2)cc1)NO |
| InChI | InChI=1S/C32H45N3O6/c36-23-25-12-14-26(15-13-25)29-20-28(22-35-18-6-2-1-3-7-19-35)40-32(41-29)27-16-10-24(11-17-27)21-33-30(37)8-4-5-9-31(38)34-39/h10-17,28-29,32,36,39H,1-9,18-23H2,(H,33,37)(H,34,38)/t28-,29+,32+/m1/s1 |
| InChIKey | UFLQYDPBCOTGNH-PRMIEGHPSA-N |
| XLogP | 4.67 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|